C27H26FN7O — CID 164514687
6-fluoro-2-N-(11-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine (PubChem CID 164514687) has the molecular formula C27H26FN7O and a molecular weight of 483.55 g/mol. Its IUPAC name is 6-fluoro-2-N-(11-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 6-fluoro-2-N-(11-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514687 |
| Molecular Formula | C27H26FN7O |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 6-fluoro-2-N-(11-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
| SMILES | Cc1c(-c2cc3nc(Nc4ccc5c(c4)C4CCC5N4C)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C27H26FN7O/c1-13-18(11-31-26-25(13)30-7-8-36-26)17-10-20-19(24(29)23(17)28)12-32-27(34-20)33-14-3-4-15-16(9-14)22-6-5-21(15)35(22)2/h3-4,9-12,21-22,30H,5-8,29H2,1-2H3,(H,32,33,34) |
| InChIKey | ODVQYFWKZNHYAO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|