C24H23FN6 — CID 164514688
6-fluoro-2-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(4-methyl-3-pyridinyl)quinazoline-2,5-diamine (PubChem CID 164514688) has the molecular formula C24H23FN6 and a molecular weight of 414.49 g/mol. Its IUPAC name is 6-fluoro-2-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(4-methyl-3-pyridinyl)quinazoline-2,5-diamine.
| Compound Name | 6-fluoro-2-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(4-methyl-3-pyridinyl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514688 |
| Molecular Formula | C24H23FN6 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 6-fluoro-2-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(4-methyl-3-pyridinyl)quinazoline-2,5-diamine |
| SMILES | Cc1ccncc1-c1cc2nc(Nc3ccc4c(c3)CN(C)CC4)ncc2c(N)c1F |
| InChI | InChI=1S/C24H23FN6/c1-14-5-7-27-11-19(14)18-10-21-20(23(26)22(18)25)12-28-24(30-21)29-17-4-3-15-6-8-31(2)13-16(15)9-17/h3-5,7,9-12H,6,8,13,26H2,1-2H3,(H,28,29,30) |
| InChIKey | DTHZGAVFGJBPQR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|