C27H28F2N6O3S — CID 164514700
2-N-[4-(ethylsulfonylmethyl)-2-fluorophenyl]-6-fluoro-7-(3,3,8-trimethyl-1,2-dihydropyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine (PubChem CID 164514700) has the molecular formula C27H28F2N6O3S and a molecular weight of 554.62 g/mol. Its IUPAC name is 2-N-[4-(ethylsulfonylmethyl)-2-fluorophenyl]-6-fluoro-7-(3,3,8-trimethyl-1,2-dihydropyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 2-N-[4-(ethylsulfonylmethyl)-2-fluorophenyl]-6-fluoro-7-(3,3,8-trimethyl-1,2-dihydropyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514700 |
| Molecular Formula | C27H28F2N6O3S |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 2-N-[4-(ethylsulfonylmethyl)-2-fluorophenyl]-6-fluoro-7-(3,3,8-trimethyl-1,2-dihydropyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
| SMILES | CCS(=O)(=O)Cc1ccc(Nc2ncc3c(N)c(F)c(-c4cnc5c(c4C)NCC(C)(C)O5)cc3n2)c(F)c1 |
| InChI | InChI=1S/C27H28F2N6O3S/c1-5-39(36,37)12-15-6-7-20(19(28)8-15)34-26-32-11-18-21(35-26)9-16(22(29)23(18)30)17-10-31-25-24(14(17)2)33-13-27(3,4)38-25/h6-11,33H,5,12-13,30H2,1-4H3,(H,32,34,35) |
| InChIKey | YJPUOEIDARQLAV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|