C26H24F3N7O — CID 164514708
2-N-(4,4-difluoro-2-methyl-1,3-dihydroisoquinolin-7-yl)-6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine (PubChem CID 164514708) has the molecular formula C26H24F3N7O and a molecular weight of 507.52 g/mol. Its IUPAC name is 2-N-(4,4-difluoro-2-methyl-1,3-dihydroisoquinolin-7-yl)-6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 2-N-(4,4-difluoro-2-methyl-1,3-dihydroisoquinolin-7-yl)-6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514708 |
| Molecular Formula | C26H24F3N7O |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-N-(4,4-difluoro-2-methyl-1,3-dihydroisoquinolin-7-yl)-6-fluoro-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
| SMILES | Cc1c(-c2cc3nc(Nc4ccc5c(c4)CN(C)CC5(F)F)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C26H24F3N7O/c1-13-17(9-32-24-23(13)31-5-6-37-24)16-8-20-18(22(30)21(16)27)10-33-25(35-20)34-15-3-4-19-14(7-15)11-36(2)12-26(19,28)29/h3-4,7-10,31H,5-6,11-12,30H2,1-2H3,(H,33,34,35) |
| InChIKey | JUGXFGLVSJMARD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|