C26H26FN7O — CID 164514711
6-fluoro-2-N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine (PubChem CID 164514711) has the molecular formula C26H26FN7O and a molecular weight of 471.54 g/mol. Its IUPAC name is 6-fluoro-2-N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 6-fluoro-2-N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514711 |
| Molecular Formula | C26H26FN7O |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 6-fluoro-2-N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
| SMILES | Cc1c(-c2cc3nc(Nc4ccc5c(c4)CCN(C)C5)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C26H26FN7O/c1-14-19(11-30-25-24(14)29-6-8-35-25)18-10-21-20(23(28)22(18)27)12-31-26(33-21)32-17-4-3-16-13-34(2)7-5-15(16)9-17/h3-4,9-12,29H,5-8,13,28H2,1-2H3,(H,31,32,33) |
| InChIKey | CCWIZDHGCDAULC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|