C33H36ClFN4O5 — CID 164514983
N-[3-[2-chloro-3-[3-fluoro-4-[[[(1S,2R)-2-hydroxycyclopentyl]amino]methyl]-5-methoxyphenyl]phenyl]-2-methylphenyl]-1,3-dimethyl-2,4-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 164514983) has the molecular formula C33H36ClFN4O5 and a molecular weight of 623.13 g/mol. Its IUPAC name is N-[3-[2-chloro-3-[3-fluoro-4-[[[(1S,2R)-2-hydroxycyclopentyl]amino]methyl]-5-methoxyphenyl]phenyl]-2-methylphenyl]-1,3-dimethyl-2,4-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-[3-[2-chloro-3-[3-fluoro-4-[[[(1S,2R)-2-hydroxycyclopentyl]amino]methyl]-5-methoxyphenyl]phenyl]-2-methylphenyl]-1,3-dimethyl-2,4-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 164514983 |
| Molecular Formula | C33H36ClFN4O5 |
| Molecular Weight | 623.13 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | N-[3-[2-chloro-3-[3-fluoro-4-[[[(1S,2R)-2-hydroxycyclopentyl]amino]methyl]-5-methoxyphenyl]phenyl]-2-methylphenyl]-1,3-dimethyl-2,4-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | COc1cc(-c2cccc(-c3cccc(NC(=O)C4CN(C)C(=O)N(C)C4=O)c3C)c2Cl)cc(F)c1CN[C@H]1CCC[C@H]1O |
| InChI | InChI=1S/C33H36ClFN4O5/c1-18-20(8-6-11-26(18)37-31(41)24-17-38(2)33(43)39(3)32(24)42)22-10-5-9-21(30(22)34)19-14-25(35)23(29(15-19)44-4)16-36-27-12-7-13-28(27)40/h5-6,8-11,14-15,24,27-28,36,40H,7,12-13,16-17H2,1-4H3,(H,37,41)/t24?,27-,28+/m0/s1 |
| InChIKey | XGDWQDWKVZBTIY-SCXVOSTRSA-N |
| XLogP | 5.21 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.13 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|