C25H26N6O — CID 164515055
(2S)-2-[2-(4-cyanophenyl)ethylamino]-2-phenyl-N-(5-pyrazolidin-4-yl-2-pyridinyl)acetamide (PubChem CID 164515055) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is (2S)-2-[2-(4-cyanophenyl)ethylamino]-2-phenyl-N-(5-pyrazolidin-4-yl-2-pyridinyl)acetamide.
| Compound Name | (2S)-2-[2-(4-cyanophenyl)ethylamino]-2-phenyl-N-(5-pyrazolidin-4-yl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 164515055 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (2S)-2-[2-(4-cyanophenyl)ethylamino]-2-phenyl-N-(5-pyrazolidin-4-yl-2-pyridinyl)acetamide |
| SMILES | N#Cc1ccc(CCN[C@H](C(=O)Nc2ccc(C3CNNC3)cn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N6O/c26-14-19-8-6-18(7-9-19)12-13-27-24(20-4-2-1-3-5-20)25(32)31-23-11-10-21(15-28-23)22-16-29-30-17-22/h1-11,15,22,24,27,29-30H,12-13,16-17H2,(H,28,31,32)/t24-/m0/s1 |
| InChIKey | RQVNDZGXKXPWRK-DEOSSOPVSA-N |
| XLogP | 2.66 |
| TPSA | 101.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |