About 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole
2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole (PubChem CID 164517178) has the molecular formula C32H35N7S
and a molecular weight of 549.75 g/mol. Its IUPAC name is 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole |
| PubChem CID | 164517178 |
| Molecular Formula | C32H35N7S |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole |
| SMILES | CN1CCN(c2ccc(-c3nc(-c4nc5ccccc5s4)[nH]c3-c3ccc(N4CCN(C)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H35N7S/c1-36-15-19-38(20-16-36)25-11-7-23(8-12-25)29-30(24-9-13-26(14-10-24)39-21-17-37(2)18-22-39)35-31(34-29)32-33-27-5-3-4-6-28(27)40-32/h3-14H,15-22H2,1-2H3,(H,34,35) |
| InChIKey | GQVJPANFTBPXFF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole?
The IUPAC name of 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole (CID 164517178) is 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole.
What is the SMILES notation for 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole?
The canonical SMILES for 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole is CN1CCN(c2ccc(-c3nc(-c4nc5ccccc5s4)[nH]c3-c3ccc(N4CCN(C)CC4)cc3)cc2)CC1.
What is the InChIKey of 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole?
The InChIKey is GQVJPANFTBPXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H35N7S/c1-36-15-19-38(20-16-36)25-11-7-23(8-12-25)29-30(24-9-13-26(14-10-24)39-21-17-37(2)18-22-39)35-31(34-29)32-33-27-5-3-4-6-28(27)40-32/h3-14H,15-22H2,1-2H3,(H,34,35).
What are the key properties of 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole?
2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole has a molecular weight of 549.75 g/mol, XLogP of 5.52, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-bis[4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazol-2-yl]-1,3-benzothiazole is sourced from PubChem (CID 164517178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).