About 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine
3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine (PubChem CID 164517202) has the molecular formula C21H33N3O
and a molecular weight of 343.52 g/mol. Its IUPAC name is 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
| PubChem CID | 164517202 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
| SMILES | CCCCCCCCCCc1ccc(-c2noc(CCCN)n2)cc1 |
| InChI | InChI=1S/C21H33N3O/c1-2-3-4-5-6-7-8-9-11-18-13-15-19(16-14-18)21-23-20(25-24-21)12-10-17-22/h13-16H,2-12,17,22H2,1H3 |
| InChIKey | VLTITRMWGPJCFJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine?
The IUPAC name of 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine (CID 164517202) is 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine.
What is the SMILES notation for 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine?
The canonical SMILES for 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine is CCCCCCCCCCc1ccc(-c2noc(CCCN)n2)cc1.
What is the InChIKey of 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine?
The InChIKey is VLTITRMWGPJCFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33N3O/c1-2-3-4-5-6-7-8-9-11-18-13-15-19(16-14-18)21-23-20(25-24-21)12-10-17-22/h13-16H,2-12,17,22H2,1H3.
What are the key properties of 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine?
3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine has a molecular weight of 343.52 g/mol, XLogP of 5.31, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine is sourced from PubChem (CID 164517202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).