About butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate
butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate (PubChem CID 164517696) has the molecular formula C15H16ClF2NO3
and a molecular weight of 331.75 g/mol. Its IUPAC name is butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate.
Molecular Properties
| Compound Name | butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate |
| PubChem CID | 164517696 |
| Molecular Formula | C15H16ClF2NO3 |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(F)(F)C(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H16ClF2NO3/c1-2-3-8-22-14(21)19-7-6-15(17,18)13(20)11-9-10(16)4-5-12(11)19/h4-5,9H,2-3,6-8H2,1H3 |
| InChIKey | TYXBSQOMNWBRNQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate?
The IUPAC name of butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate (CID 164517696) is butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate.
What is the SMILES notation for butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate?
The canonical SMILES for butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate is CCCCOC(=O)N1CCC(F)(F)C(=O)c2cc(Cl)ccc21.
What is the InChIKey of butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate?
The InChIKey is TYXBSQOMNWBRNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClF2NO3/c1-2-3-8-22-14(21)19-7-6-15(17,18)13(20)11-9-10(16)4-5-12(11)19/h4-5,9H,2-3,6-8H2,1H3.
What are the key properties of butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate?
butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate has a molecular weight of 331.75 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 7-chloro-4,4-difluoro-5-oxo-2,3-dihydro-1-benzazepine-1-carboxylate is sourced from PubChem (CID 164517696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).