About 4,8,12-trimethylpentadecane-1,15-diol
4,8,12-trimethylpentadecane-1,15-diol (PubChem CID 164518613) has the molecular formula C18H38O2
and a molecular weight of 286.50 g/mol. Its IUPAC name is 4,8,12-trimethylpentadecane-1,15-diol.
Molecular Properties
| Compound Name | 4,8,12-trimethylpentadecane-1,15-diol |
| PubChem CID | 164518613 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 4,8,12-trimethylpentadecane-1,15-diol |
| SMILES | CC(CCCO)CCCC(C)CCCC(C)CCCO |
| InChI | InChI=1S/C18H38O2/c1-16(8-4-10-17(2)12-6-14-19)9-5-11-18(3)13-7-15-20/h16-20H,4-15H2,1-3H3 |
| InChIKey | PGPBJPHVOMMUGR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,8,12-trimethylpentadecane-1,15-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8,12-trimethylpentadecane-1,15-diol?
The IUPAC name of 4,8,12-trimethylpentadecane-1,15-diol (CID 164518613) is 4,8,12-trimethylpentadecane-1,15-diol.
What is the SMILES notation for 4,8,12-trimethylpentadecane-1,15-diol?
The canonical SMILES for 4,8,12-trimethylpentadecane-1,15-diol is CC(CCCO)CCCC(C)CCCC(C)CCCO.
What is the InChIKey of 4,8,12-trimethylpentadecane-1,15-diol?
The InChIKey is PGPBJPHVOMMUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O2/c1-16(8-4-10-17(2)12-6-14-19)9-5-11-18(3)13-7-15-20/h16-20H,4-15H2,1-3H3.
What are the key properties of 4,8,12-trimethylpentadecane-1,15-diol?
4,8,12-trimethylpentadecane-1,15-diol has a molecular weight of 286.50 g/mol, XLogP of 4.78, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8,12-trimethylpentadecane-1,15-diol is sourced from PubChem (CID 164518613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).