C37H51FN6O5S — CID 164519154
tert-butyl (3R)-3-[3-[[6-[(6-tert-butyl-2-fluoropyridine-3-carbonyl)sulfamoyl]-2-pyridinyl]amino]-3-(4-tert-butyl-2-pyridinyl)propyl]piperidine-1-carboxylate (PubChem CID 164519154) has the molecular formula C37H51FN6O5S and a molecular weight of 710.92 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-[[6-[(6-tert-butyl-2-fluoropyridine-3-carbonyl)sulfamoyl]-2-pyridinyl]amino]-3-(4-tert-butyl-2-pyridinyl)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[3-[[6-[(6-tert-butyl-2-fluoropyridine-3-carbonyl)sulfamoyl]-2-pyridinyl]amino]-3-(4-tert-butyl-2-pyridinyl)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164519154 |
| Molecular Formula | C37H51FN6O5S |
| Molecular Weight | 710.92 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | tert-butyl (3R)-3-[3-[[6-[(6-tert-butyl-2-fluoropyridine-3-carbonyl)sulfamoyl]-2-pyridinyl]amino]-3-(4-tert-butyl-2-pyridinyl)propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](CCC(Nc2cccc(S(=O)(=O)NC(=O)c3ccc(C(C)(C)C)nc3F)n2)c2cc(C(C)(C)C)ccn2)C1 |
| InChI | InChI=1S/C37H51FN6O5S/c1-35(2,3)25-19-20-39-28(22-25)27(17-15-24-12-11-21-44(23-24)34(46)49-37(7,8)9)40-30-13-10-14-31(42-30)50(47,48)43-33(45)26-16-18-29(36(4,5)6)41-32(26)38/h10,13-14,16,18-20,22,24,27H,11-12,15,17,21,23H2,1-9H3,(H,40,42)(H,43,45)/t24-,27?/m1/s1 |
| InChIKey | WETYFPGJXKEGLI-DXDQHDRFSA-N |
| XLogP | 7.30 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.92 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|