C25H40N6O3S — CID 164519187
(14S,17R)-12,12-dimethyl-2,2-dioxo-17-pyridin-2-yl-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosan-4-one (PubChem CID 164519187) has the molecular formula C25H40N6O3S and a molecular weight of 504.70 g/mol. Its IUPAC name is (14S,17R)-12,12-dimethyl-2,2-dioxo-17-pyridin-2-yl-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosan-4-one.
| Compound Name | (14S,17R)-12,12-dimethyl-2,2-dioxo-17-pyridin-2-yl-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosan-4-one |
|---|---|
| PubChem CID | 164519187 |
| Molecular Formula | C25H40N6O3S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | (14S,17R)-12,12-dimethyl-2,2-dioxo-17-pyridin-2-yl-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosan-4-one |
| SMILES | CC1(C)C[C@@H]2CC[C@H](c3ccccn3)NC3CCCC(N3)S(=O)(=O)NC(=O)C3CCCNC3N1C2 |
| InChI | InChI=1S/C25H40N6O3S/c1-25(2)15-17-11-12-20(19-8-3-4-13-26-19)28-21-9-5-10-22(29-21)35(33,34)30-24(32)18-7-6-14-27-23(18)31(25)16-17/h3-4,8,13,17-18,20-23,27-29H,5-7,9-12,14-16H2,1-2H3,(H,30,32)/t17-,18?,20+,21?,22?,23?/m0/s1 |
| InChIKey | WOJYJCWQNAKTKY-SZJDCPTGSA-N |
| XLogP | 1.80 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |