About 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene
1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene (PubChem CID 164519749) has the molecular formula C14H12BrF3O2
and a molecular weight of 349.15 g/mol. Its IUPAC name is 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene.
Molecular Properties
| Compound Name | 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene |
| PubChem CID | 164519749 |
| Molecular Formula | C14H12BrF3O2 |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene |
| SMILES | COCOC(c1cc(Br)c2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C14H12BrF3O2/c1-19-8-20-13(14(16,17)18)10-6-9-4-2-3-5-11(9)12(15)7-10/h2-7,13H,8H2,1H3 |
| InChIKey | AHJSFVFAJAEHSJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene?
The IUPAC name of 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene (CID 164519749) is 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene.
What is the SMILES notation for 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene?
The canonical SMILES for 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene is COCOC(c1cc(Br)c2ccccc2c1)C(F)(F)F.
What is the InChIKey of 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene?
The InChIKey is AHJSFVFAJAEHSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrF3O2/c1-19-8-20-13(14(16,17)18)10-6-9-4-2-3-5-11(9)12(15)7-10/h2-7,13H,8H2,1H3.
What are the key properties of 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene?
1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene has a molecular weight of 349.15 g/mol, XLogP of 4.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-[2,2,2-trifluoro-1-(methoxymethoxy)ethyl]naphthalene is sourced from PubChem (CID 164519749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).