About hexyl 2-diazopropanoate
hexyl 2-diazopropanoate (PubChem CID 164520840) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is hexyl 2-diazopropanoate.
Molecular Properties
| Compound Name | hexyl 2-diazopropanoate |
| PubChem CID | 164520840 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | hexyl 2-diazopropanoate |
| SMILES | CCCCCCOC(=O)C(C)=[N+]=[N-] |
| InChI | InChI=1S/C9H16N2O2/c1-3-4-5-6-7-13-9(12)8(2)11-10/h3-7H2,1-2H3 |
| InChIKey | HDMZEBZUFLWKDZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze hexyl 2-diazopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 2-diazopropanoate?
The IUPAC name of hexyl 2-diazopropanoate (CID 164520840) is hexyl 2-diazopropanoate.
What is the SMILES notation for hexyl 2-diazopropanoate?
The canonical SMILES for hexyl 2-diazopropanoate is CCCCCCOC(=O)C(C)=[N+]=[N-].
What is the InChIKey of hexyl 2-diazopropanoate?
The InChIKey is HDMZEBZUFLWKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-3-4-5-6-7-13-9(12)8(2)11-10/h3-7H2,1-2H3.
What are the key properties of hexyl 2-diazopropanoate?
hexyl 2-diazopropanoate has a molecular weight of 184.24 g/mol, XLogP of 1.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 2-diazopropanoate is sourced from PubChem (CID 164520840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).