C33H33FN6O — CID 164521255
4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 164521255) has the molecular formula C33H33FN6O and a molecular weight of 548.67 g/mol. Its IUPAC name is 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 164521255 |
| Molecular Formula | C33H33FN6O |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | C#Cc1cccc2cccc(-c3ncc4c(N5C[C@H]6CC[C@@H](C5)N6)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C33H33FN6O/c1-2-21-7-3-8-22-9-4-10-25(27(21)22)29-28(34)30-26(17-35-29)31(39-18-23-11-12-24(19-39)36-23)38-32(37-30)41-20-33-13-5-15-40(33)16-6-14-33/h1,3-4,7-10,17,23-24,36H,5-6,11-16,18-20H2/t23-,24+ |
| InChIKey | BCLKNFZNEWVYNN-PSWAGMNNSA-N |
| XLogP | 4.91 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|