C32H39F2N7O3 — CID 164521256
tert-butyl (1R,5S)-3-[7-(2-amino-6-fluorophenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 164521256) has the molecular formula C32H39F2N7O3 and a molecular weight of 607.71 g/mol. Its IUPAC name is tert-butyl (1R,5S)-3-[7-(2-amino-6-fluorophenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1R,5S)-3-[7-(2-amino-6-fluorophenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 164521256 |
| Molecular Formula | C32H39F2N7O3 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | tert-butyl (1R,5S)-3-[7-(2-amino-6-fluorophenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CN(c1nc(OCC34CCCN3CCC4)nc3c(F)c(-c4c(N)cccc4F)ncc13)C2 |
| InChI | InChI=1S/C32H39F2N7O3/c1-31(2,3)44-30(42)41-19-9-10-20(41)17-39(16-19)28-21-15-36-27(24-22(33)7-4-8-23(24)35)25(34)26(21)37-29(38-28)43-18-32-11-5-13-40(32)14-6-12-32/h4,7-8,15,19-20H,5-6,9-14,16-18,35H2,1-3H3/t19-,20+ |
| InChIKey | HLNAHRSSUPEXDF-BGYRXZFFSA-N |
| XLogP | 5.15 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|