C16H20N4 — CID 164521550
2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]pyrido[4,3-d]pyrimidine (PubChem CID 164521550) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]pyrido[4,3-d]pyrimidine.
| Compound Name | 2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 164521550 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]pyrido[4,3-d]pyrimidine |
| SMILES | c1cc2nc(CCC34CCCN3CCC4)ncc2cn1 |
| InChI | InChI=1S/C16H20N4/c1-5-16(6-2-10-20(16)9-1)7-3-15-18-12-13-11-17-8-4-14(13)19-15/h4,8,11-12H,1-3,5-7,9-10H2 |
| InChIKey | QQIOWXQYOOXGJH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |