C24H31F2NOSi — CID 164521674
tert-butyl-[(2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-diphenylsilane (PubChem CID 164521674) has the molecular formula C24H31F2NOSi and a molecular weight of 415.60 g/mol. Its IUPAC name is tert-butyl-[(2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 164521674 |
| Molecular Formula | C24H31F2NOSi |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | tert-butyl-[(2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC12CC(F)CN1CC(F)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31F2NOSi/c1-23(2,3)29(21-10-6-4-7-11-21,22-12-8-5-9-13-22)28-18-24-14-19(25)16-27(24)17-20(26)15-24/h4-13,19-20H,14-18H2,1-3H3 |
| InChIKey | BSOBORALZCXZEW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|