C15H17FN4O — CID 164521699
8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 164521699) has the molecular formula C15H17FN4O and a molecular weight of 288.33 g/mol. Its IUPAC name is 8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 164521699 |
| Molecular Formula | C15H17FN4O |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | Fc1cncc2cnc(OCC34CCCN3CCC4)nc12 |
| InChI | InChI=1S/C15H17FN4O/c16-12-9-17-7-11-8-18-14(19-13(11)12)21-10-15-3-1-5-20(15)6-2-4-15/h7-9H,1-6,10H2 |
| InChIKey | OJBBOLDGWRMJRP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |