C21H25ClF2N6O — CID 164521713
7-chloro-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine (PubChem CID 164521713) has the molecular formula C21H25ClF2N6O and a molecular weight of 450.92 g/mol. Its IUPAC name is 7-chloro-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 164521713 |
| Molecular Formula | C21H25ClF2N6O |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 7-chloro-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(Cl)ncc2c(N3C[C@H]4CC[C@@H](C3)N4)nc(OCC34CCCN3CC(F)C4)nc12 |
| InChI | InChI=1S/C21H25ClF2N6O/c22-18-16(24)17-15(7-25-18)19(29-9-13-2-3-14(10-29)26-13)28-20(27-17)31-11-21-4-1-5-30(21)8-12(23)6-21/h7,12-14,26H,1-6,8-11H2/t12?,13-,14+,21? |
| InChIKey | YAGFSWKWGSDOQE-ZYOHURMISA-N |
| XLogP | 2.71 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|