C32H35FN6O — CID 164521791
4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(8-methylnaphthalen-1-yl)pyrido[4,3-d]pyrimidine (PubChem CID 164521791) has the molecular formula C32H35FN6O and a molecular weight of 538.67 g/mol. Its IUPAC name is 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(8-methylnaphthalen-1-yl)pyrido[4,3-d]pyrimidine.
| Compound Name | 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(8-methylnaphthalen-1-yl)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 164521791 |
| Molecular Formula | C32H35FN6O |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(8-methylnaphthalen-1-yl)pyrido[4,3-d]pyrimidine |
| SMILES | Cc1cccc2cccc(-c3ncc4c(N5C[C@H]6CC[C@@H](C5)N6)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C32H35FN6O/c1-20-6-2-7-21-8-3-9-24(26(20)21)28-27(33)29-25(16-34-28)30(38-17-22-10-11-23(18-38)35-22)37-31(36-29)40-19-32-12-4-14-39(32)15-5-13-32/h2-3,6-9,16,22-23,35H,4-5,10-15,17-19H2,1H3/t22-,23+ |
| InChIKey | AMVILNMLIZTTSD-ZRZAMGCNSA-N |
| XLogP | 5.24 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |