C15H22O8 — CID 164522024
methyl 2-acetyl-3,3,4,4,5-pentamethoxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 164522024) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is methyl 2-acetyl-3,3,4,4,5-pentamethoxycyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 2-acetyl-3,3,4,4,5-pentamethoxycyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 164522024 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | methyl 2-acetyl-3,3,4,4,5-pentamethoxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(C(C)=O)C(OC)(OC)C(OC)(OC)C(OC)=C1 |
| InChI | InChI=1S/C15H22O8/c1-9(16)12-10(13(17)19-3)8-11(18-2)14(20-4,21-5)15(12,22-6)23-7/h8H,1-7H3 |
| InChIKey | MBXBSEBPQYOWEJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|