C15H21F3N4O3 — CID 164522773
tert-butyl N-[3-[[2,2-difluoro-2-(1-methylpyrazol-4-yl)acetyl]-fluoroamino]cyclobutyl]carbamate (PubChem CID 164522773) has the molecular formula C15H21F3N4O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is tert-butyl N-[3-[[2,2-difluoro-2-(1-methylpyrazol-4-yl)acetyl]-fluoroamino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2,2-difluoro-2-(1-methylpyrazol-4-yl)acetyl]-fluoroamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 164522773 |
| Molecular Formula | C15H21F3N4O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | tert-butyl N-[3-[[2,2-difluoro-2-(1-methylpyrazol-4-yl)acetyl]-fluoroamino]cyclobutyl]carbamate |
| SMILES | Cn1cc(C(F)(F)C(=O)N(F)C2CC(NC(=O)OC(C)(C)C)C2)cn1 |
| InChI | InChI=1S/C15H21F3N4O3/c1-14(2,3)25-13(24)20-10-5-11(6-10)22(18)12(23)15(16,17)9-7-19-21(4)8-9/h7-8,10-11H,5-6H2,1-4H3,(H,20,24) |
| InChIKey | ALUJCNLKBJQXRT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|