About 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride
7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride (PubChem CID 164523227) has the molecular formula C6H6ClN3O
and a molecular weight of 171.59 g/mol. Its IUPAC name is 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride.
Molecular Properties
| Compound Name | 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride |
| PubChem CID | 164523227 |
| Molecular Formula | C6H6ClN3O |
| Molecular Weight | 171.59 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride |
| SMILES | Cl.O=c1[nH]ccn2cncc12 |
| InChI | InChI=1S/C6H5N3O.ClH/c10-6-5-3-7-4-9(5)2-1-8-6;/h1-4H,(H,8,10);1H |
| InChIKey | LSSUOPCRELMJGN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.59 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride?
The IUPAC name of 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride (CID 164523227) is 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride.
What is the SMILES notation for 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride?
The canonical SMILES for 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride is Cl.O=c1[nH]ccn2cncc12.
What is the InChIKey of 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride?
The InChIKey is LSSUOPCRELMJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O.ClH/c10-6-5-3-7-4-9(5)2-1-8-6;/h1-4H,(H,8,10);1H.
What are the key properties of 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride?
7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride has a molecular weight of 171.59 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-imidazo[1,5-a]pyrazin-8-one;hydrochloride is sourced from PubChem (CID 164523227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).