About benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate
benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate (PubChem CID 164523260) has the molecular formula C19H16F3NO3
and a molecular weight of 363.34 g/mol. Its IUPAC name is benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate.
Molecular Properties
| Compound Name | benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate |
| PubChem CID | 164523260 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate |
| SMILES | CC(=O)N/C(=C\C(=O)OCc1ccccc1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H16F3NO3/c1-12(24)23-15(7-14-8-17(21)18(22)10-16(14)20)9-19(25)26-11-13-5-3-2-4-6-13/h2-6,8-10H,7,11H2,1H3,(H,23,24)/b15-9- |
| InChIKey | DUYRBOWARZMYTO-DHDCSXOGSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate?
The IUPAC name of benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate (CID 164523260) is benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate.
What is the SMILES notation for benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate?
The canonical SMILES for benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate is CC(=O)N/C(=C\C(=O)OCc1ccccc1)Cc1cc(F)c(F)cc1F.
What is the InChIKey of benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate?
The InChIKey is DUYRBOWARZMYTO-DHDCSXOGSA-N. The full InChI is InChI=1S/C19H16F3NO3/c1-12(24)23-15(7-14-8-17(21)18(22)10-16(14)20)9-19(25)26-11-13-5-3-2-4-6-13/h2-6,8-10H,7,11H2,1H3,(H,23,24)/b15-9-.
What are the key properties of benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate?
benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate has a molecular weight of 363.34 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (Z)-3-acetamido-4-(2,4,5-trifluorophenyl)but-2-enoate is sourced from PubChem (CID 164523260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).