C12H14ClNO — CID 164523796
3-[(2-chlorophenyl)methyl]-4,4-dimethyl-5H-1,2-oxazole (PubChem CID 164523796) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-4,4-dimethyl-5H-1,2-oxazole.
| Compound Name | 3-[(2-chlorophenyl)methyl]-4,4-dimethyl-5H-1,2-oxazole |
|---|---|
| PubChem CID | 164523796 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-4,4-dimethyl-5H-1,2-oxazole |
| SMILES | CC1(C)CON=C1Cc1ccccc1Cl |
| InChI | InChI=1S/C12H14ClNO/c1-12(2)8-15-14-11(12)7-9-5-3-4-6-10(9)13/h3-6H,7-8H2,1-2H3 |
| InChIKey | OSKQBYLNHVOHLE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |