About 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one
3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one (PubChem CID 164523828) has the molecular formula C28H21N2O2P
and a molecular weight of 448.46 g/mol. Its IUPAC name is 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one |
| PubChem CID | 164523828 |
| Molecular Formula | C28H21N2O2P |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1n1cc(P(=O)(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H21N2O2P/c31-28-27(22-15-7-9-17-24(22)29-28)30-19-26(23-16-8-10-18-25(23)30)33(32,20-11-3-1-4-12-20)21-13-5-2-6-14-21/h1-19,27H,(H,29,31) |
| InChIKey | SPZHJFKCXMICGH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one?
The IUPAC name of 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one (CID 164523828) is 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one?
The canonical SMILES for 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one is O=C1Nc2ccccc2C1n1cc(P(=O)(c2ccccc2)c2ccccc2)c2ccccc21.
What is the InChIKey of 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one?
The InChIKey is SPZHJFKCXMICGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H21N2O2P/c31-28-27(22-15-7-9-17-24(22)29-28)30-19-26(23-16-8-10-18-25(23)30)33(32,20-11-3-1-4-12-20)21-13-5-2-6-14-21/h1-19,27H,(H,29,31).
What are the key properties of 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one?
3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one has a molecular weight of 448.46 g/mol, XLogP of 4.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-diphenylphosphorylindol-1-yl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 164523828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).