About N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride
N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride (PubChem CID 164523943) has the molecular formula C21H18ClN3O2
and a molecular weight of 379.85 g/mol. Its IUPAC name is N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride |
| PubChem CID | 164523943 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride |
| SMILES | Cc1ccc2nc(-c3ccc(CNC(=O)c4cccnc4)cc3)oc2c1.Cl |
| InChI | InChI=1S/C21H17N3O2.ClH/c1-14-4-9-18-19(11-14)26-21(24-18)16-7-5-15(6-8-16)12-23-20(25)17-3-2-10-22-13-17;/h2-11,13H,12H2,1H3,(H,23,25);1H |
| InChIKey | ZCGVORIOHOIPBC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride?
The IUPAC name of N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride (CID 164523943) is N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride.
What is the SMILES notation for N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride?
The canonical SMILES for N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride is Cc1ccc2nc(-c3ccc(CNC(=O)c4cccnc4)cc3)oc2c1.Cl.
What is the InChIKey of N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride?
The InChIKey is ZCGVORIOHOIPBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O2.ClH/c1-14-4-9-18-19(11-14)26-21(24-18)16-7-5-15(6-8-16)12-23-20(25)17-3-2-10-22-13-17;/h2-11,13H,12H2,1H3,(H,23,25);1H.
What are the key properties of N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride?
N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride has a molecular weight of 379.85 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methyl]pyridine-3-carboxamide;hydrochloride is sourced from PubChem (CID 164523943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).