About 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline
1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline (PubChem CID 164524264) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline |
| PubChem CID | 164524264 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline |
| SMILES | CC(C)c1ccc2c(c1)C=CNC2C |
| InChI | InChI=1S/C13H17N/c1-9(2)11-4-5-13-10(3)14-7-6-12(13)8-11/h4-10,14H,1-3H3 |
| InChIKey | OKVKAEGNKYJTAC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline?
The IUPAC name of 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline (CID 164524264) is 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline.
What is the SMILES notation for 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline?
The canonical SMILES for 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline is CC(C)c1ccc2c(c1)C=CNC2C.
What is the InChIKey of 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline?
The InChIKey is OKVKAEGNKYJTAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-9(2)11-4-5-13-10(3)14-7-6-12(13)8-11/h4-10,14H,1-3H3.
What are the key properties of 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline?
1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline has a molecular weight of 187.29 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-propan-2-yl-1,2-dihydroisoquinoline is sourced from PubChem (CID 164524264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).