About 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one
7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one (PubChem CID 164524469) has the molecular formula C20H15NO4
and a molecular weight of 333.34 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one |
| PubChem CID | 164524469 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one |
| SMILES | Cc1noc(C)c1-c1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C20H15NO4/c1-11-19(12(2)25-21-11)14-8-15(22)20-16(23)10-17(24-18(20)9-14)13-6-4-3-5-7-13/h3-10,22H,1-2H3 |
| InChIKey | ODPZOVMEPGSOGH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one?
The IUPAC name of 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one (CID 164524469) is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one.
What is the SMILES notation for 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one?
The canonical SMILES for 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one is Cc1noc(C)c1-c1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1.
What is the InChIKey of 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one?
The InChIKey is ODPZOVMEPGSOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO4/c1-11-19(12(2)25-21-11)14-8-15(22)20-16(23)10-17(24-18(20)9-14)13-6-4-3-5-7-13/h3-10,22H,1-2H3.
What are the key properties of 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one?
7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one has a molecular weight of 333.34 g/mol, XLogP of 4.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,5-dimethyl-1,2-oxazol-4-yl)-5-hydroxy-2-phenylchromen-4-one is sourced from PubChem (CID 164524469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).