About 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one
1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one (PubChem CID 164524868) has the molecular formula C23H23FOS
and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one.
Molecular Properties
| Compound Name | 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one |
| PubChem CID | 164524868 |
| Molecular Formula | C23H23FOS |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one |
| SMILES | CC(C)C(=O)Cc1ccc(S(F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23FOS/c1-18(2)23(25)17-19-13-15-22(16-14-19)26(24,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,18H,17H2,1-2H3 |
| InChIKey | LHZFHKORVBJRIE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one?
The IUPAC name of 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one (CID 164524868) is 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one.
What is the SMILES notation for 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one?
The canonical SMILES for 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one is CC(C)C(=O)Cc1ccc(S(F)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one?
The InChIKey is LHZFHKORVBJRIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FOS/c1-18(2)23(25)17-19-13-15-22(16-14-19)26(24,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,18H,17H2,1-2H3.
What are the key properties of 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one?
1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one has a molecular weight of 366.50 g/mol, XLogP of 6.62, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[fluoro(diphenyl)-λ4-sulfanyl]phenyl]-3-methylbutan-2-one is sourced from PubChem (CID 164524868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).