About 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine
5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine (PubChem CID 164525019) has the molecular formula C8H11N3OS2
and a molecular weight of 229.33 g/mol. Its IUPAC name is 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine.
Molecular Properties
| Compound Name | 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine |
| PubChem CID | 164525019 |
| Molecular Formula | C8H11N3OS2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine |
| SMILES | CCS(=O)c1ccc(C#N)nc1.NS |
| InChI | InChI=1S/C8H8N2OS.H3NS/c1-2-12(11)8-4-3-7(5-9)10-6-8;1-2/h3-4,6H,2H2,1H3;2H,1H2 |
| InChIKey | LGAAMQHCRWISKR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine?
The IUPAC name of 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine (CID 164525019) is 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine.
What is the SMILES notation for 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine?
The canonical SMILES for 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine is CCS(=O)c1ccc(C#N)nc1.NS.
What is the InChIKey of 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine?
The InChIKey is LGAAMQHCRWISKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS.H3NS/c1-2-12(11)8-4-3-7(5-9)10-6-8;1-2/h3-4,6H,2H2,1H3;2H,1H2.
What are the key properties of 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine?
5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine has a molecular weight of 229.33 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfinylpyridine-2-carbonitrile;thiohydroxylamine is sourced from PubChem (CID 164525019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).