C19H22F7N5O — CID 164525035
2-[2-[(S)-amino-(4,4-difluorocyclohexyl)methyl]imidazo[1,2-b]pyridazin-7-yl]-4,4-difluoro-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 164525035) has the molecular formula C19H22F7N5O and a molecular weight of 469.41 g/mol. Its IUPAC name is 2-[2-[(S)-amino-(4,4-difluorocyclohexyl)methyl]imidazo[1,2-b]pyridazin-7-yl]-4,4-difluoro-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 2-[2-[(S)-amino-(4,4-difluorocyclohexyl)methyl]imidazo[1,2-b]pyridazin-7-yl]-4,4-difluoro-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 164525035 |
| Molecular Formula | C19H22F7N5O |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 2-[2-[(S)-amino-(4,4-difluorocyclohexyl)methyl]imidazo[1,2-b]pyridazin-7-yl]-4,4-difluoro-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | N[C@H](c1cn2ncc(C(CC(F)F)C(=O)NCC(F)(F)F)cc2n1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H22F7N5O/c20-14(21)6-12(17(32)28-9-19(24,25)26)11-5-15-30-13(8-31(15)29-7-11)16(27)10-1-3-18(22,23)4-2-10/h5,7-8,10,12,14,16H,1-4,6,9,27H2,(H,28,32)/t12?,16-/m0/s1 |
| InChIKey | QUJRHRMIPYPWKH-INSVYWFGSA-N |
| XLogP | 3.97 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |