About S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate
S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate (PubChem CID 164525093) has the molecular formula C18H19FO3S2
and a molecular weight of 366.48 g/mol. Its IUPAC name is S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate.
Molecular Properties
| Compound Name | S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate |
| PubChem CID | 164525093 |
| Molecular Formula | C18H19FO3S2 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCCCCCCOc1cc2cc(F)ccc2oc1=S |
| InChI | InChI=1S/C18H19FO3S2/c1-2-17(20)24-10-6-4-3-5-9-21-16-12-13-11-14(19)7-8-15(13)22-18(16)23/h2,7-8,11-12H,1,3-6,9-10H2 |
| InChIKey | UVDUILUQIXQMCY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate?
The IUPAC name of S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate (CID 164525093) is S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate.
What is the SMILES notation for S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate?
The canonical SMILES for S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate is C=CC(=O)SCCCCCCOc1cc2cc(F)ccc2oc1=S.
What is the InChIKey of S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate?
The InChIKey is UVDUILUQIXQMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FO3S2/c1-2-17(20)24-10-6-4-3-5-9-21-16-12-13-11-14(19)7-8-15(13)22-18(16)23/h2,7-8,11-12H,1,3-6,9-10H2.
What are the key properties of S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate?
S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate has a molecular weight of 366.48 g/mol, XLogP of 5.69, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] prop-2-enethioate is sourced from PubChem (CID 164525093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).