C25H35FO6S — CID 164525099
2-[2-[2-(8-fluoro-2-oxochromen-4-yl)oxyethoxy]ethylsulfanyl]ethyl 2,2,3,5-tetramethylhexanoate (PubChem CID 164525099) has the molecular formula C25H35FO6S and a molecular weight of 482.61 g/mol. Its IUPAC name is 2-[2-[2-(8-fluoro-2-oxochromen-4-yl)oxyethoxy]ethylsulfanyl]ethyl 2,2,3,5-tetramethylhexanoate.
| Compound Name | 2-[2-[2-(8-fluoro-2-oxochromen-4-yl)oxyethoxy]ethylsulfanyl]ethyl 2,2,3,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 164525099 |
| Molecular Formula | C25H35FO6S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-[2-[2-(8-fluoro-2-oxochromen-4-yl)oxyethoxy]ethylsulfanyl]ethyl 2,2,3,5-tetramethylhexanoate |
| SMILES | CC(C)CC(C)C(C)(C)C(=O)OCCSCCOCCOc1cc(=O)oc2c(F)cccc12 |
| InChI | InChI=1S/C25H35FO6S/c1-17(2)15-18(3)25(4,5)24(28)31-12-14-33-13-11-29-9-10-30-21-16-22(27)32-23-19(21)7-6-8-20(23)26/h6-8,16-18H,9-15H2,1-5H3 |
| InChIKey | LGYLPFDOMRKCRV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|