About 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate
8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate (PubChem CID 164525243) has the molecular formula C22H31NO3S
and a molecular weight of 389.56 g/mol. Its IUPAC name is 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate |
| PubChem CID | 164525243 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCCCCCOc1cc(=S)n(C)c2ccccc12 |
| InChI | InChI=1S/C22H31NO3S/c1-17(2)22(24)26-15-11-7-5-4-6-10-14-25-20-16-21(27)23(3)19-13-9-8-12-18(19)20/h8-9,12-13,16-17H,4-7,10-11,14-15H2,1-3H3 |
| InChIKey | GEQKCOSGOQTWPK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate?
The IUPAC name of 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate (CID 164525243) is 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate.
What is the SMILES notation for 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate?
The canonical SMILES for 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate is CC(C)C(=O)OCCCCCCCCOc1cc(=S)n(C)c2ccccc12.
What is the InChIKey of 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate?
The InChIKey is GEQKCOSGOQTWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO3S/c1-17(2)22(24)26-15-11-7-5-4-6-10-14-25-20-16-21(27)23(3)19-13-9-8-12-18(19)20/h8-9,12-13,16-17H,4-7,10-11,14-15H2,1-3H3.
What are the key properties of 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate?
8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate has a molecular weight of 389.56 g/mol, XLogP of 5.83, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-methyl-2-sulfanylidenequinolin-4-yl)oxyoctyl 2-methylpropanoate is sourced from PubChem (CID 164525243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).