C27H39FO4S — CID 164525308
S-[8-(8-fluoro-2-oxochromen-4-yl)oxyoctyl] 2,2,3,5-tetramethylhexanethioate (PubChem CID 164525308) has the molecular formula C27H39FO4S and a molecular weight of 478.67 g/mol. Its IUPAC name is S-[8-(8-fluoro-2-oxochromen-4-yl)oxyoctyl] 2,2,3,5-tetramethylhexanethioate.
| Compound Name | S-[8-(8-fluoro-2-oxochromen-4-yl)oxyoctyl] 2,2,3,5-tetramethylhexanethioate |
|---|---|
| PubChem CID | 164525308 |
| Molecular Formula | C27H39FO4S |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | S-[8-(8-fluoro-2-oxochromen-4-yl)oxyoctyl] 2,2,3,5-tetramethylhexanethioate |
| SMILES | CC(C)CC(C)C(C)(C)C(=O)SCCCCCCCCOc1cc(=O)oc2c(F)cccc12 |
| InChI | InChI=1S/C27H39FO4S/c1-19(2)17-20(3)27(4,5)26(30)33-16-11-9-7-6-8-10-15-31-23-18-24(29)32-25-21(23)13-12-14-22(25)28/h12-14,18-20H,6-11,15-17H2,1-5H3 |
| InChIKey | DAGDBXLGFQICMT-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|