C28H42O4S — CID 164525510
6-cyclopentylsulfanyl-4-[4-(2,3,5,5-tetramethylhexan-2-yloxy)butoxy]chromen-2-one (PubChem CID 164525510) has the molecular formula C28H42O4S and a molecular weight of 474.71 g/mol. Its IUPAC name is 6-cyclopentylsulfanyl-4-[4-(2,3,5,5-tetramethylhexan-2-yloxy)butoxy]chromen-2-one.
| Compound Name | 6-cyclopentylsulfanyl-4-[4-(2,3,5,5-tetramethylhexan-2-yloxy)butoxy]chromen-2-one |
|---|---|
| PubChem CID | 164525510 |
| Molecular Formula | C28H42O4S |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 6-cyclopentylsulfanyl-4-[4-(2,3,5,5-tetramethylhexan-2-yloxy)butoxy]chromen-2-one |
| SMILES | CC(CC(C)(C)C)C(C)(C)OCCCCOc1cc(=O)oc2ccc(SC3CCCC3)cc12 |
| InChI | InChI=1S/C28H42O4S/c1-20(19-27(2,3)4)28(5,6)31-16-10-9-15-30-25-18-26(29)32-24-14-13-22(17-23(24)25)33-21-11-7-8-12-21/h13-14,17-18,20-21H,7-12,15-16,19H2,1-6H3 |
| InChIKey | ZJCLTFPTONNVGE-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|