About 4-chloro-6-fluoro-2,5-dimethylpyrimidine
4-chloro-6-fluoro-2,5-dimethylpyrimidine (PubChem CID 164525965) has the molecular formula C6H6ClFN2
and a molecular weight of 160.58 g/mol. Its IUPAC name is 4-chloro-6-fluoro-2,5-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-fluoro-2,5-dimethylpyrimidine |
| PubChem CID | 164525965 |
| Molecular Formula | C6H6ClFN2 |
| Molecular Weight | 160.58 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 4-chloro-6-fluoro-2,5-dimethylpyrimidine |
| SMILES | Cc1nc(F)c(C)c(Cl)n1 |
| InChI | InChI=1S/C6H6ClFN2/c1-3-5(7)9-4(2)10-6(3)8/h1-2H3 |
| InChIKey | VSGRIJMDHUJTNR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.58 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-6-fluoro-2,5-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-fluoro-2,5-dimethylpyrimidine?
The IUPAC name of 4-chloro-6-fluoro-2,5-dimethylpyrimidine (CID 164525965) is 4-chloro-6-fluoro-2,5-dimethylpyrimidine.
What is the SMILES notation for 4-chloro-6-fluoro-2,5-dimethylpyrimidine?
The canonical SMILES for 4-chloro-6-fluoro-2,5-dimethylpyrimidine is Cc1nc(F)c(C)c(Cl)n1.
What is the InChIKey of 4-chloro-6-fluoro-2,5-dimethylpyrimidine?
The InChIKey is VSGRIJMDHUJTNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClFN2/c1-3-5(7)9-4(2)10-6(3)8/h1-2H3.
What are the key properties of 4-chloro-6-fluoro-2,5-dimethylpyrimidine?
4-chloro-6-fluoro-2,5-dimethylpyrimidine has a molecular weight of 160.58 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-fluoro-2,5-dimethylpyrimidine is sourced from PubChem (CID 164525965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).