C20H17F6N3O2 — CID 164526190
N-[(4R)-4-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]-5-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 164526190) has the molecular formula C20H17F6N3O2 and a molecular weight of 445.36 g/mol. Its IUPAC name is N-[(4R)-4-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]-5-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-[(4R)-4-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]-5-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164526190 |
| Molecular Formula | C20H17F6N3O2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[(4R)-4-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]-5-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | C[C@H]1CN(C(=O)C(F)(F)F)Cc2cc(NC(=O)c3cncc(CC(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C20H17F6N3O2/c1-11-9-29(18(31)20(24,25)26)10-14-5-15(2-3-16(11)14)28-17(30)13-4-12(7-27-8-13)6-19(21,22)23/h2-5,7-8,11H,6,9-10H2,1H3,(H,28,30)/t11-/m0/s1 |
| InChIKey | XPLPTAAWCQOKBV-NSHDSACASA-N |
| XLogP | 4.45 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |