About ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide
ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide (PubChem CID 164526353) has the molecular formula C18H32N2O
and a molecular weight of 292.47 g/mol. Its IUPAC name is ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide.
Molecular Properties
| Compound Name | ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide |
| PubChem CID | 164526353 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide |
| SMILES | C/C=C(CNC(=O)C(/C=C(\C)CC)=C/C)\N=C\CC.CC |
| InChI | InChI=1S/C16H26N2O.C2H6/c1-6-10-17-15(9-4)12-18-16(19)14(8-3)11-13(5)7-2;1-2/h8-11H,6-7,12H2,1-5H3,(H,18,19);1-2H3/b13-11+,14-8+,15-9-,17-10+; |
| InChIKey | QTZVILFEGVEQPG-NXSZSTSLSA-N |
| XLogP | 4.82 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide?
The IUPAC name of ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide (CID 164526353) is ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide.
What is the SMILES notation for ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide?
The canonical SMILES for ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide is C/C=C(CNC(=O)C(/C=C(\C)CC)=C/C)\N=C\CC.CC.
What is the InChIKey of ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide?
The InChIKey is QTZVILFEGVEQPG-NXSZSTSLSA-N. The full InChI is InChI=1S/C16H26N2O.C2H6/c1-6-10-17-15(9-4)12-18-16(19)14(8-3)11-13(5)7-2;1-2/h8-11H,6-7,12H2,1-5H3,(H,18,19);1-2H3/b13-11+,14-8+,15-9-,17-10+;.
What are the key properties of ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide?
ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide has a molecular weight of 292.47 g/mol, XLogP of 4.82, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E,2E)-2-ethylidene-4-methyl-N-[(Z)-2-(propylideneamino)but-2-enyl]hex-3-enamide is sourced from PubChem (CID 164526353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).