About lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate
lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate (PubChem CID 164526442) has the molecular formula C9H11LiN2O2S
and a molecular weight of 218.21 g/mol. Its IUPAC name is lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate |
| PubChem CID | 164526442 |
| Molecular Formula | C9H11LiN2O2S |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate |
| SMILES | O=C([O-])c1ncc(CN2CCCC2)s1.[Li+] |
| InChI | InChI=1S/C9H12N2O2S.Li/c12-9(13)8-10-5-7(14-8)6-11-3-1-2-4-11;/h5H,1-4,6H2,(H,12,13);/q;+1/p-1 |
| InChIKey | NEDWGRUBHPUUJP-UHFFFAOYSA-M |
| XLogP | -2.89 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate?
The IUPAC name of lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate (CID 164526442) is lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate.
What is the SMILES notation for lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate?
The canonical SMILES for lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate is O=C([O-])c1ncc(CN2CCCC2)s1.[Li+].
What is the InChIKey of lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate?
The InChIKey is NEDWGRUBHPUUJP-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12N2O2S.Li/c12-9(13)8-10-5-7(14-8)6-11-3-1-2-4-11;/h5H,1-4,6H2,(H,12,13);/q;+1/p-1.
What are the key properties of lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate?
lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate has a molecular weight of 218.21 g/mol, XLogP of -2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 5-(pyrrolidin-1-ylmethyl)-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 164526442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).