C13H12FNO3 — CID 164527005
methyl 3-(5-ethyl-1,2-oxazol-4-yl)-5-fluorobenzoate (PubChem CID 164527005) has the molecular formula C13H12FNO3 and a molecular weight of 249.24 g/mol. Its IUPAC name is methyl 3-(5-ethyl-1,2-oxazol-4-yl)-5-fluorobenzoate.
| Compound Name | methyl 3-(5-ethyl-1,2-oxazol-4-yl)-5-fluorobenzoate |
|---|---|
| PubChem CID | 164527005 |
| Molecular Formula | C13H12FNO3 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | methyl 3-(5-ethyl-1,2-oxazol-4-yl)-5-fluorobenzoate |
| SMILES | CCc1oncc1-c1cc(F)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C13H12FNO3/c1-3-12-11(7-15-18-12)8-4-9(13(16)17-2)6-10(14)5-8/h4-7H,3H2,1-2H3 |
| InChIKey | HRFAPTADTZRBLT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |