About CID 164528332
CID 164528332 (PubChem CID 164528332) has the molecular formula C20H28ClN
and a molecular weight of 317.90 g/mol.
Molecular Properties
| Compound Name | CID 164528332 |
| PubChem CID | 164528332 |
| Molecular Formula | C20H28ClN |
| Molecular Weight | 317.90 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | — |
| SMILES | Cc1cnc2c(c1Cl)C1(CCCCC1)CCC21CCCCC1 |
| InChI | InChI=1S/C20H28ClN/c1-15-14-22-18-16(17(15)21)19(8-4-2-5-9-19)12-13-20(18)10-6-3-7-11-20/h14H,2-13H2,1H3 |
| InChIKey | QKQJUBKNTIAQHQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.90 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 164528332 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164528332?
The IUPAC name of CID 164528332 (CID 164528332) is not available.
What is the SMILES notation for CID 164528332?
The canonical SMILES for CID 164528332 is Cc1cnc2c(c1Cl)C1(CCCCC1)CCC21CCCCC1.
What is the InChIKey of CID 164528332?
The InChIKey is QKQJUBKNTIAQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28ClN/c1-15-14-22-18-16(17(15)21)19(8-4-2-5-9-19)12-13-20(18)10-6-3-7-11-20/h14H,2-13H2,1H3.
What are the key properties of CID 164528332?
CID 164528332 has a molecular weight of 317.90 g/mol, XLogP of 6.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164528332 is sourced from PubChem (CID 164528332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).