C45H36BNO5 — CID 164528439
CID 164528439 (PubChem CID 164528439) has the molecular formula C45H36BNO5 and a molecular weight of 681.60 g/mol.
| Compound Name | CID 164528439 |
|---|---|
| PubChem CID | 164528439 |
| Molecular Formula | C45H36BNO5 |
| Molecular Weight | 681.60 g/mol |
| Exact Mass | 681.27 |
| IUPAC Name | — |
| SMILES | [B]C12CCC(O)(CC1)c1cc3c4c5c(cc6c7cc8c(cc7n(c3cc1C2=O)c64)C(=O)C1(O)CCC8(O)CC1)-c1cccc2cccc(c12)C5(C)C |
| InChI | InChI=1S/C45H36BNO5/c1-41(2)30-8-4-6-22-5-3-7-23(35(22)30)25-17-26-24-18-31-28(40(49)45(52)15-13-44(31,51)14-16-45)21-33(24)47-34-20-27-32(19-29(34)36(37(25)41)38(26)47)43(50)11-9-42(46,10-12-43)39(27)48/h3-8,17-21,50-52H,9-16H2,1-2H3 |
| InChIKey | GFPIXDLJDMCEEF-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.60 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|