C14H12F3NO3S — CID 164528977
(6-cyano-3-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl) trifluoromethanesulfonate (PubChem CID 164528977) has the molecular formula C14H12F3NO3S and a molecular weight of 331.32 g/mol. Its IUPAC name is (6-cyano-3-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl) trifluoromethanesulfonate.
| Compound Name | (6-cyano-3-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164528977 |
| Molecular Formula | C14H12F3NO3S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (6-cyano-3-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl) trifluoromethanesulfonate |
| SMILES | N#Cc1ccc(OS(=O)(=O)C(F)(F)F)c2c1C1CCC2CC1 |
| InChI | InChI=1S/C14H12F3NO3S/c15-14(16,17)22(19,20)21-11-6-5-10(7-18)12-8-1-3-9(4-2-8)13(11)12/h5-6,8-9H,1-4H2 |
| InChIKey | YAXMNROGDIVPGT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|