About CID 164529176
CID 164529176 (PubChem CID 164529176) has the molecular formula C12H10B2O5
and a molecular weight of 255.83 g/mol.
Molecular Properties
| Compound Name | CID 164529176 |
| PubChem CID | 164529176 |
| Molecular Formula | C12H10B2O5 |
| Molecular Weight | 255.83 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | — |
| SMILES | [B]c1c(O)c(B(O)O)c(O)c(O)c1-c1ccccc1 |
| InChI | InChI=1S/C12H10B2O5/c13-8-7(6-4-2-1-3-5-6)10(15)12(17)9(11(8)16)14(18)19/h1-5,15-19H |
| InChIKey | MPXNBZQWPJCZEK-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.83 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 164529176 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164529176?
The IUPAC name of CID 164529176 (CID 164529176) is not available.
What is the SMILES notation for CID 164529176?
The canonical SMILES for CID 164529176 is [B]c1c(O)c(B(O)O)c(O)c(O)c1-c1ccccc1.
What is the InChIKey of CID 164529176?
The InChIKey is MPXNBZQWPJCZEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10B2O5/c13-8-7(6-4-2-1-3-5-6)10(15)12(17)9(11(8)16)14(18)19/h1-5,15-19H.
What are the key properties of CID 164529176?
CID 164529176 has a molecular weight of 255.83 g/mol, XLogP of -1.06, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164529176 is sourced from PubChem (CID 164529176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).