C13H24N4O — CID 164529462
2-[[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]amino]-N,N-diethylacetamide (PubChem CID 164529462) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]amino]-N,N-diethylacetamide.
| Compound Name | 2-[[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 164529462 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-[[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNC1=N[C@@H]2CCCC[C@@H]2N1 |
| InChI | InChI=1S/C13H24N4O/c1-3-17(4-2)12(18)9-14-13-15-10-7-5-6-8-11(10)16-13/h10-11H,3-9H2,1-2H3,(H2,14,15,16)/t10-,11+ |
| InChIKey | ZHZRULLNMPNTDC-PHIMTYICSA-N |
| XLogP | 0.71 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |