C22H24F2N6O3S — CID 164529596
4-[[6-[2,6-difluoro-3-(pyrrolidin-1-ylsulfanylamino)phenyl]-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]butanoic acid (PubChem CID 164529596) has the molecular formula C22H24F2N6O3S and a molecular weight of 490.54 g/mol. Its IUPAC name is 4-[[6-[2,6-difluoro-3-(pyrrolidin-1-ylsulfanylamino)phenyl]-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[6-[2,6-difluoro-3-(pyrrolidin-1-ylsulfanylamino)phenyl]-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 164529596 |
| Molecular Formula | C22H24F2N6O3S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 4-[[6-[2,6-difluoro-3-(pyrrolidin-1-ylsulfanylamino)phenyl]-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]butanoic acid |
| SMILES | Cn1c(=O)c(-c2c(F)ccc(NSN3CCCC3)c2F)cc2cnc(NCCCC(=O)O)nc21 |
| InChI | InChI=1S/C22H24F2N6O3S/c1-29-20-13(12-26-22(27-20)25-8-4-5-17(31)32)11-14(21(29)33)18-15(23)6-7-16(19(18)24)28-34-30-9-2-3-10-30/h6-7,11-12,28H,2-5,8-10H2,1H3,(H,31,32)(H,25,26,27) |
| InChIKey | RHDOJVQXJYNOEF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|